C17H15ClN4O2S — CID 163247535
N-[3-[[4-chloro-6-(2-methylphenoxy)pyrimidin-2-yl]amino]sulfanylphenyl]hydroxylamine (PubChem CID 163247535) has the molecular formula C17H15ClN4O2S and a molecular weight of 374.85 g/mol. Its IUPAC name is N-[3-[[4-chloro-6-(2-methylphenoxy)pyrimidin-2-yl]amino]sulfanylphenyl]hydroxylamine.
| Compound Name | N-[3-[[4-chloro-6-(2-methylphenoxy)pyrimidin-2-yl]amino]sulfanylphenyl]hydroxylamine |
|---|---|
| PubChem CID | 163247535 |
| Molecular Formula | C17H15ClN4O2S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | N-[3-[[4-chloro-6-(2-methylphenoxy)pyrimidin-2-yl]amino]sulfanylphenyl]hydroxylamine |
| SMILES | Cc1ccccc1Oc1cc(Cl)nc(NSc2cccc(NO)c2)n1 |
| InChI | InChI=1S/C17H15ClN4O2S/c1-11-5-2-3-8-14(11)24-16-10-15(18)19-17(20-16)22-25-13-7-4-6-12(9-13)21-23/h2-10,21,23H,1H3,(H,19,20,22) |
| InChIKey | VCRJWSKXQLLRDA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|