C17H16ClN4O2S+ — CID 163247468
[3-[(4-chloro-6-phenoxypyrimidin-2-yl)amino]sulfanylphenyl]-methoxyazanium (PubChem CID 163247468) has the molecular formula C17H16ClN4O2S+ and a molecular weight of 375.86 g/mol. Its IUPAC name is [3-[(4-chloro-6-phenoxypyrimidin-2-yl)amino]sulfanylphenyl]-methoxyazanium.
| Compound Name | [3-[(4-chloro-6-phenoxypyrimidin-2-yl)amino]sulfanylphenyl]-methoxyazanium |
|---|---|
| PubChem CID | 163247468 |
| Molecular Formula | C17H16ClN4O2S+ |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | [3-[(4-chloro-6-phenoxypyrimidin-2-yl)amino]sulfanylphenyl]-methoxyazanium |
| SMILES | CO[NH2+]c1cccc(SNc2nc(Cl)cc(Oc3ccccc3)n2)c1 |
| InChI | InChI=1S/C17H15ClN4O2S/c1-23-21-12-6-5-9-14(10-12)25-22-17-19-15(18)11-16(20-17)24-13-7-3-2-4-8-13/h2-11,21H,1H3,(H,19,20,22)/p+1 |
| InChIKey | QSGUYAYQXGRYKD-UHFFFAOYSA-O |
| XLogP | 3.80 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|