C35H32ClN5O2S — CID 174000978
2-[4-[2-[(1-amino-3-trityliminoprop-1-en-2-yl)sulfanylamino]-6-chloropyrimidin-4-yl]oxyphenyl]propan-2-ol (PubChem CID 174000978) has the molecular formula C35H32ClN5O2S and a molecular weight of 622.19 g/mol. Its IUPAC name is 2-[4-[2-[(1-amino-3-trityliminoprop-1-en-2-yl)sulfanylamino]-6-chloropyrimidin-4-yl]oxyphenyl]propan-2-ol.
| Compound Name | 2-[4-[2-[(1-amino-3-trityliminoprop-1-en-2-yl)sulfanylamino]-6-chloropyrimidin-4-yl]oxyphenyl]propan-2-ol |
|---|---|
| PubChem CID | 174000978 |
| Molecular Formula | C35H32ClN5O2S |
| Molecular Weight | 622.19 g/mol |
| Exact Mass | 621.20 |
| IUPAC Name | 2-[4-[2-[(1-amino-3-trityliminoprop-1-en-2-yl)sulfanylamino]-6-chloropyrimidin-4-yl]oxyphenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(Oc2cc(Cl)nc(NSC(=CN)/C=N/C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C35H32ClN5O2S/c1-34(2,42)25-18-20-29(21-19-25)43-32-22-31(36)39-33(40-32)41-44-30(23-37)24-38-35(26-12-6-3-7-13-26,27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3-24,42H,37H2,1-2H3,(H,39,40,41)/b30-23?,38-24+ |
| InChIKey | XTTHFLNXDQUZQI-AFZGBVLXSA-N |
| XLogP | 8.07 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.19 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|