C32H43N7O2S — CID 174001046
N-(1-amino-3-methyliminoprop-1-en-2-yl)sulfanyl-4-[3-methoxy-2-(4-methylpentyl)phenyl]-6-[4-(4-methylpiperazin-1-yl)phenoxy]pyrimidin-2-amine (PubChem CID 174001046) has the molecular formula C32H43N7O2S and a molecular weight of 589.81 g/mol. Its IUPAC name is N-(1-amino-3-methyliminoprop-1-en-2-yl)sulfanyl-4-[3-methoxy-2-(4-methylpentyl)phenyl]-6-[4-(4-methylpiperazin-1-yl)phenoxy]pyrimidin-2-amine.
| Compound Name | N-(1-amino-3-methyliminoprop-1-en-2-yl)sulfanyl-4-[3-methoxy-2-(4-methylpentyl)phenyl]-6-[4-(4-methylpiperazin-1-yl)phenoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 174001046 |
| Molecular Formula | C32H43N7O2S |
| Molecular Weight | 589.81 g/mol |
| Exact Mass | 589.32 |
| IUPAC Name | N-(1-amino-3-methyliminoprop-1-en-2-yl)sulfanyl-4-[3-methoxy-2-(4-methylpentyl)phenyl]-6-[4-(4-methylpiperazin-1-yl)phenoxy]pyrimidin-2-amine |
| SMILES | C/N=C/C(=CN)SNc1nc(Oc2ccc(N3CCN(C)CC3)cc2)cc(-c2cccc(OC)c2CCCC(C)C)n1 |
| InChI | InChI=1S/C32H43N7O2S/c1-23(2)8-6-10-28-27(9-7-11-30(28)40-5)29-20-31(36-32(35-29)37-42-26(21-33)22-34-3)41-25-14-12-24(13-15-25)39-18-16-38(4)17-19-39/h7,9,11-15,20-23H,6,8,10,16-19,33H2,1-5H3,(H,35,36,37)/b26-21?,34-22+ |
| InChIKey | JJLIBMUTHYRBGS-GEOZOCLTSA-N |
| XLogP | 6.24 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.81 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|