C25H25N4O2S+ — CID 163246970
methoxy-[3-[[4-(2-methylphenoxy)-6-(2-methylphenyl)pyrimidin-2-yl]amino]sulfanylphenyl]azanium (PubChem CID 163246970) has the molecular formula C25H25N4O2S+ and a molecular weight of 445.57 g/mol. Its IUPAC name is methoxy-[3-[[4-(2-methylphenoxy)-6-(2-methylphenyl)pyrimidin-2-yl]amino]sulfanylphenyl]azanium.
| Compound Name | methoxy-[3-[[4-(2-methylphenoxy)-6-(2-methylphenyl)pyrimidin-2-yl]amino]sulfanylphenyl]azanium |
|---|---|
| PubChem CID | 163246970 |
| Molecular Formula | C25H25N4O2S+ |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | methoxy-[3-[[4-(2-methylphenoxy)-6-(2-methylphenyl)pyrimidin-2-yl]amino]sulfanylphenyl]azanium |
| SMILES | CO[NH2+]c1cccc(SNc2nc(Oc3ccccc3C)cc(-c3ccccc3C)n2)c1 |
| InChI | InChI=1S/C25H24N4O2S/c1-17-9-4-6-13-21(17)22-16-24(31-23-14-7-5-10-18(23)2)27-25(26-22)29-32-20-12-8-11-19(15-20)28-30-3/h4-16,28H,1-3H3,(H,26,27,29)/p+1 |
| InChIKey | NJBFGPUWAFTXDN-UHFFFAOYSA-O |
| XLogP | 5.43 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|