C12H23F2N3 — CID 170397196
1-(1-ethyl-3,3-difluoropiperidin-4-yl)-4-methylpiperazine (PubChem CID 170397196) has the molecular formula C12H23F2N3 and a molecular weight of 247.33 g/mol. Its IUPAC name is 1-(1-ethyl-3,3-difluoropiperidin-4-yl)-4-methylpiperazine.
| Compound Name | 1-(1-ethyl-3,3-difluoropiperidin-4-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 170397196 |
| Molecular Formula | C12H23F2N3 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 1-(1-ethyl-3,3-difluoropiperidin-4-yl)-4-methylpiperazine |
| SMILES | CCN1CCC(N2CCN(C)CC2)C(F)(F)C1 |
| InChI | InChI=1S/C12H23F2N3/c1-3-16-5-4-11(12(13,14)10-16)17-8-6-15(2)7-9-17/h11H,3-10H2,1-2H3 |
| InChIKey | SWUJHSOUUQYIEZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |