C17H36N2S2 — CID 170402213
[4-[(4-tert-butylpiperidin-1-yl)methyl]piperidin-1-yl]-dimethyl-sulfanyl-λ4-sulfane (PubChem CID 170402213) has the molecular formula C17H36N2S2 and a molecular weight of 332.62 g/mol. Its IUPAC name is [4-[(4-tert-butylpiperidin-1-yl)methyl]piperidin-1-yl]-dimethyl-sulfanyl-λ4-sulfane.
| Compound Name | [4-[(4-tert-butylpiperidin-1-yl)methyl]piperidin-1-yl]-dimethyl-sulfanyl-λ4-sulfane |
|---|---|
| PubChem CID | 170402213 |
| Molecular Formula | C17H36N2S2 |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | [4-[(4-tert-butylpiperidin-1-yl)methyl]piperidin-1-yl]-dimethyl-sulfanyl-λ4-sulfane |
| SMILES | CC(C)(C)C1CCN(CC2CCN(S(C)(C)S)CC2)CC1 |
| InChI | InChI=1S/C17H36N2S2/c1-17(2,3)16-8-10-18(11-9-16)14-15-6-12-19(13-7-15)21(4,5)20/h15-16,20H,6-14H2,1-5H3 |
| InChIKey | PPEUNVZVDSPIIC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|