C20H24N2O7S — CID 170404596
2-[[[2-[[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylamino]phenyl]-hydroxymethyl]amino]acetic acid (PubChem CID 170404596) has the molecular formula C20H24N2O7S and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-[[[2-[[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylamino]phenyl]-hydroxymethyl]amino]acetic acid.
| Compound Name | 2-[[[2-[[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylamino]phenyl]-hydroxymethyl]amino]acetic acid |
|---|---|
| PubChem CID | 170404596 |
| Molecular Formula | C20H24N2O7S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[[[2-[[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylamino]phenyl]-hydroxymethyl]amino]acetic acid |
| SMILES | CC(C)(C)C(=O)Oc1ccc(S(=O)(=O)Nc2ccccc2C(O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C20H24N2O7S/c1-20(2,3)19(26)29-13-8-10-14(11-9-13)30(27,28)22-16-7-5-4-6-15(16)18(25)21-12-17(23)24/h4-11,18,21-22,25H,12H2,1-3H3,(H,23,24) |
| InChIKey | CPIHYRUJPHHWIQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|