C30H21NO13 — CID 170408405
5-[2-(5-amino-2-hydroxybenzoyl)oxy-3-(2-carboxy-4-oxochromen-5-yl)oxypropoxy]-4-oxochromene-2-carboxylic acid (PubChem CID 170408405) has the molecular formula C30H21NO13 and a molecular weight of 603.49 g/mol. Its IUPAC name is 5-[2-(5-amino-2-hydroxybenzoyl)oxy-3-(2-carboxy-4-oxochromen-5-yl)oxypropoxy]-4-oxochromene-2-carboxylic acid.
| Compound Name | 5-[2-(5-amino-2-hydroxybenzoyl)oxy-3-(2-carboxy-4-oxochromen-5-yl)oxypropoxy]-4-oxochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 170408405 |
| Molecular Formula | C30H21NO13 |
| Molecular Weight | 603.49 g/mol |
| Exact Mass | 603.10 |
| IUPAC Name | 5-[2-(5-amino-2-hydroxybenzoyl)oxy-3-(2-carboxy-4-oxochromen-5-yl)oxypropoxy]-4-oxochromene-2-carboxylic acid |
| SMILES | Nc1ccc(O)c(C(=O)OC(COc2cccc3oc(C(=O)O)cc(=O)c23)COc2cccc3oc(C(=O)O)cc(=O)c23)c1 |
| InChI | InChI=1S/C30H21NO13/c31-14-7-8-17(32)16(9-14)30(39)42-15(12-40-20-3-1-5-22-26(20)18(33)10-24(43-22)28(35)36)13-41-21-4-2-6-23-27(21)19(34)11-25(44-23)29(37)38/h1-11,15,32H,12-13,31H2,(H,35,36)(H,37,38) |
| InChIKey | OVNXDONRJMXSIB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 226.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|