C22H26O2 — CID 170409781
(4S)-5,6,7,8-tetramethyl-4-(3,4,5-trimethylphenyl)-3,4-dihydrochromen-2-one (PubChem CID 170409781) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is (4S)-5,6,7,8-tetramethyl-4-(3,4,5-trimethylphenyl)-3,4-dihydrochromen-2-one.
| Compound Name | (4S)-5,6,7,8-tetramethyl-4-(3,4,5-trimethylphenyl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 170409781 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (4S)-5,6,7,8-tetramethyl-4-(3,4,5-trimethylphenyl)-3,4-dihydrochromen-2-one |
| SMILES | Cc1cc([C@@H]2CC(=O)Oc3c(C)c(C)c(C)c(C)c32)cc(C)c1C |
| InChI | InChI=1S/C22H26O2/c1-11-8-18(9-12(2)13(11)3)19-10-20(23)24-22-17(7)15(5)14(4)16(6)21(19)22/h8-9,19H,10H2,1-7H3/t19-/m0/s1 |
| InChIKey | GNXNYIDNTPDRDJ-IBGZPJMESA-N |
| XLogP | 5.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|