C21H18O4 — CID 102552242
7,8,10-trimethyl-4-phenyl-3,4-dihydropyrano[3,2-c]chromene-2,5-dione (PubChem CID 102552242) has the molecular formula C21H18O4 and a molecular weight of 334.37 g/mol. Its IUPAC name is 7,8,10-trimethyl-4-phenyl-3,4-dihydropyrano[3,2-c]chromene-2,5-dione.
| Compound Name | 7,8,10-trimethyl-4-phenyl-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
|---|---|
| PubChem CID | 102552242 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 7,8,10-trimethyl-4-phenyl-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
| SMILES | Cc1cc(C)c2c3c(c(=O)oc2c1C)C(c1ccccc1)CC(=O)O3 |
| InChI | InChI=1S/C21H18O4/c1-11-9-12(2)17-19(13(11)3)25-21(23)18-15(10-16(22)24-20(17)18)14-7-5-4-6-8-14/h4-9,15H,10H2,1-3H3 |
| InChIKey | VYROLMIHXWVQHZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|