C28H32FN3O2 — CID 170412076
5-[[(1R,2R)-2-[2-(2-fluoro-3-pyridinyl)ethyl]cyclohexyl]methyl]-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one (PubChem CID 170412076) has the molecular formula C28H32FN3O2 and a molecular weight of 461.58 g/mol. Its IUPAC name is 5-[[(1R,2R)-2-[2-(2-fluoro-3-pyridinyl)ethyl]cyclohexyl]methyl]-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one.
| Compound Name | 5-[[(1R,2R)-2-[2-(2-fluoro-3-pyridinyl)ethyl]cyclohexyl]methyl]-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 170412076 |
| Molecular Formula | C28H32FN3O2 |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 5-[[(1R,2R)-2-[2-(2-fluoro-3-pyridinyl)ethyl]cyclohexyl]methyl]-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
| SMILES | C=C1CCC(N2Cc3cc(C[C@H]4CCCC[C@@H]4CCc4cccnc4F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H32FN3O2/c1-18-8-13-25(27(33)31-18)32-17-23-16-19(9-12-24(23)28(32)34)15-22-6-3-2-5-20(22)10-11-21-7-4-14-30-26(21)29/h4,7,9,12,14,16,20,22,25H,1-3,5-6,8,10-11,13,15,17H2,(H,31,33)/t20-,22-,25?/m1/s1 |
| InChIKey | SZYWEQICKWOGDR-OBNZWGTRSA-N |
| XLogP | 4.95 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|