C34H49N5O5S — CID 170412962
N-[4-[(2R)-2-[[butyl(1-methoxypropan-2-yl)amino]-methylamino]-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-3-formylbenzenesulfonamide (PubChem CID 170412962) has the molecular formula C34H49N5O5S and a molecular weight of 639.86 g/mol. Its IUPAC name is N-[4-[(2R)-2-[[butyl(1-methoxypropan-2-yl)amino]-methylamino]-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-3-formylbenzenesulfonamide.
| Compound Name | N-[4-[(2R)-2-[[butyl(1-methoxypropan-2-yl)amino]-methylamino]-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-3-formylbenzenesulfonamide |
|---|---|
| PubChem CID | 170412962 |
| Molecular Formula | C34H49N5O5S |
| Molecular Weight | 639.86 g/mol |
| Exact Mass | 639.35 |
| IUPAC Name | N-[4-[(2R)-2-[[butyl(1-methoxypropan-2-yl)amino]-methylamino]-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-3-formylbenzenesulfonamide |
| SMILES | CCCCN(C(C)COC)N(C)[C@@H](COc1cc(-c2c(C)cccc2C)nc(NS(=O)(=O)c2cccc(C=O)c2)n1)CC(C)C |
| InChI | InChI=1S/C34H49N5O5S/c1-9-10-17-39(27(6)22-43-8)38(7)29(18-24(2)3)23-44-32-20-31(33-25(4)13-11-14-26(33)5)35-34(36-32)37-45(41,42)30-16-12-15-28(19-30)21-40/h11-16,19-21,24,27,29H,9-10,17-18,22-23H2,1-8H3,(H,35,36,37)/t27?,29-/m1/s1 |
| InChIKey | CSVAMRQLXXXQQF-ZBAATNBSSA-N |
| XLogP | 6.15 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.86 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|