C33H47N5O6S — CID 170413734
N-[4-[(2R)-2-[[butyl-[(2S)-2,3-dihydroxypropyl]amino]-methylamino]-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-3-formylbenzenesulfonamide (PubChem CID 170413734) has the molecular formula C33H47N5O6S and a molecular weight of 641.84 g/mol. Its IUPAC name is N-[4-[(2R)-2-[[butyl-[(2S)-2,3-dihydroxypropyl]amino]-methylamino]-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-3-formylbenzenesulfonamide.
| Compound Name | N-[4-[(2R)-2-[[butyl-[(2S)-2,3-dihydroxypropyl]amino]-methylamino]-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-3-formylbenzenesulfonamide |
|---|---|
| PubChem CID | 170413734 |
| Molecular Formula | C33H47N5O6S |
| Molecular Weight | 641.84 g/mol |
| Exact Mass | 641.32 |
| IUPAC Name | N-[4-[(2R)-2-[[butyl-[(2S)-2,3-dihydroxypropyl]amino]-methylamino]-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-3-formylbenzenesulfonamide |
| SMILES | CCCCN(C[C@H](O)CO)N(C)[C@@H](COc1cc(-c2c(C)cccc2C)nc(NS(=O)(=O)c2cccc(C=O)c2)n1)CC(C)C |
| InChI | InChI=1S/C33H47N5O6S/c1-7-8-15-38(19-28(41)21-40)37(6)27(16-23(2)3)22-44-31-18-30(32-24(4)11-9-12-25(32)5)34-33(35-31)36-45(42,43)29-14-10-13-26(17-29)20-39/h9-14,17-18,20,23,27-28,40-41H,7-8,15-16,19,21-22H2,1-6H3,(H,34,35,36)/t27-,28+/m1/s1 |
| InChIKey | WKGCEYPNFAWTLK-IZLXSDGUSA-N |
| XLogP | 4.47 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.84 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|