C15H7F15 — CID 170413980
1-methyl-1,2,2,3,3-pentakis(trifluoromethyl)indene (PubChem CID 170413980) has the molecular formula C15H7F15 and a molecular weight of 472.19 g/mol. Its IUPAC name is 1-methyl-1,2,2,3,3-pentakis(trifluoromethyl)indene.
| Compound Name | 1-methyl-1,2,2,3,3-pentakis(trifluoromethyl)indene |
|---|---|
| PubChem CID | 170413980 |
| Molecular Formula | C15H7F15 |
| Molecular Weight | 472.19 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 1-methyl-1,2,2,3,3-pentakis(trifluoromethyl)indene |
| SMILES | CC1(C(F)(F)F)c2ccccc2C(C(F)(F)F)(C(F)(F)F)C1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H7F15/c1-8(11(16,17)18)6-4-2-3-5-7(6)9(12(19,20)21,13(22,23)24)10(8,14(25,26)27)15(28,29)30/h2-5H,1H3 |
| InChIKey | UTUKOKOZVUEBIA-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.19 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |