C16H24N4O4 — CID 170430147
(2-ethyl-4-methylimidazol-1-yl) acetate;2-(2-ethyl-4-methylimidazol-1-yl)acetic acid (PubChem CID 170430147) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is (2-ethyl-4-methylimidazol-1-yl) acetate;2-(2-ethyl-4-methylimidazol-1-yl)acetic acid.
| Compound Name | (2-ethyl-4-methylimidazol-1-yl) acetate;2-(2-ethyl-4-methylimidazol-1-yl)acetic acid |
|---|---|
| PubChem CID | 170430147 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (2-ethyl-4-methylimidazol-1-yl) acetate;2-(2-ethyl-4-methylimidazol-1-yl)acetic acid |
| SMILES | CCc1nc(C)cn1CC(=O)O.CCc1nc(C)cn1OC(C)=O |
| InChI | InChI=1S/2C8H12N2O2/c1-4-8-9-6(2)5-10(8)12-7(3)11;1-3-7-9-6(2)4-10(7)5-8(11)12/h5H,4H2,1-3H3;4H,3,5H2,1-2H3,(H,11,12) |
| InChIKey | IRULFYHBZZRIFX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |