C8H13F2NO5S — CID 170430197
3,3-difluoro-4-(methylsulfonyloxymethyl)piperidine-1-carboxylic acid (PubChem CID 170430197) has the molecular formula C8H13F2NO5S and a molecular weight of 273.26 g/mol. Its IUPAC name is 3,3-difluoro-4-(methylsulfonyloxymethyl)piperidine-1-carboxylic acid.
| Compound Name | 3,3-difluoro-4-(methylsulfonyloxymethyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 170430197 |
| Molecular Formula | C8H13F2NO5S |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 3,3-difluoro-4-(methylsulfonyloxymethyl)piperidine-1-carboxylic acid |
| SMILES | CS(=O)(=O)OCC1CCN(C(=O)O)CC1(F)F |
| InChI | InChI=1S/C8H13F2NO5S/c1-17(14,15)16-4-6-2-3-11(7(12)13)5-8(6,9)10/h6H,2-5H2,1H3,(H,12,13) |
| InChIKey | YKNRUNXPYFTVKK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|