C9H12F2N2O2 — CID 131988920
4-(2-cyanoethyl)-3,3-difluoropiperidine-1-carboxylic acid (PubChem CID 131988920) has the molecular formula C9H12F2N2O2 and a molecular weight of 218.20 g/mol. Its IUPAC name is 4-(2-cyanoethyl)-3,3-difluoropiperidine-1-carboxylic acid.
| Compound Name | 4-(2-cyanoethyl)-3,3-difluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 131988920 |
| Molecular Formula | C9H12F2N2O2 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-(2-cyanoethyl)-3,3-difluoropiperidine-1-carboxylic acid |
| SMILES | N#CCCC1CCN(C(=O)O)CC1(F)F |
| InChI | InChI=1S/C9H12F2N2O2/c10-9(11)6-13(8(14)15)5-3-7(9)2-1-4-12/h7H,1-3,5-6H2,(H,14,15) |
| InChIKey | QYDIWNCKTGJARJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |