C7H9F2NO4 — CID 144706599
3,3-difluoropiperidine-1,4-dicarboxylic acid (PubChem CID 144706599) has the molecular formula C7H9F2NO4 and a molecular weight of 209.15 g/mol. Its IUPAC name is 3,3-difluoropiperidine-1,4-dicarboxylic acid.
| Compound Name | 3,3-difluoropiperidine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 144706599 |
| Molecular Formula | C7H9F2NO4 |
| Molecular Weight | 209.15 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 3,3-difluoropiperidine-1,4-dicarboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)O)CC1(F)F |
| InChI | InChI=1S/C7H9F2NO4/c8-7(9)3-10(6(13)14)2-1-4(7)5(11)12/h4H,1-3H2,(H,11,12)(H,13,14) |
| InChIKey | UCSPJRGLYHOTOQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.15 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |