C20H20Cl2F3N2O5S- — CID 170430449
1,2-dichloro-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-[N-sulfinato-4-(trifluoromethoxy)anilino]ethyl]benzene (PubChem CID 170430449) has the molecular formula C20H20Cl2F3N2O5S- and a molecular weight of 528.36 g/mol. Its IUPAC name is 1,2-dichloro-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-[N-sulfinato-4-(trifluoromethoxy)anilino]ethyl]benzene.
| Compound Name | 1,2-dichloro-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-[N-sulfinato-4-(trifluoromethoxy)anilino]ethyl]benzene |
|---|---|
| PubChem CID | 170430449 |
| Molecular Formula | C20H20Cl2F3N2O5S- |
| Molecular Weight | 528.36 g/mol |
| Exact Mass | 527.04 |
| IUPAC Name | 1,2-dichloro-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-[N-sulfinato-4-(trifluoromethoxy)anilino]ethyl]benzene |
| SMILES | CC(C)(C)OC(=O)NCC(c1ccc(Cl)c(Cl)c1)N(c1ccc(OC(F)(F)F)cc1)S(=O)[O-] |
| InChI | InChI=1S/C20H21Cl2F3N2O5S/c1-19(2,3)32-18(28)26-11-17(12-4-9-15(21)16(22)10-12)27(33(29)30)13-5-7-14(8-6-13)31-20(23,24)25/h4-10,17H,11H2,1-3H3,(H,26,28)(H,29,30)/p-1 |
| InChIKey | GMLUMHVJHWPIGJ-UHFFFAOYSA-M |
| XLogP | 5.76 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.36 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|