C23H28N4O5S — CID 170434649
3-[4-[3-ethynyl-1-(oxan-2-yl)indazol-5-yl]-1-methylpyrazol-5-yl]oxybutyl methanesulfonate (PubChem CID 170434649) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is 3-[4-[3-ethynyl-1-(oxan-2-yl)indazol-5-yl]-1-methylpyrazol-5-yl]oxybutyl methanesulfonate.
| Compound Name | 3-[4-[3-ethynyl-1-(oxan-2-yl)indazol-5-yl]-1-methylpyrazol-5-yl]oxybutyl methanesulfonate |
|---|---|
| PubChem CID | 170434649 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 3-[4-[3-ethynyl-1-(oxan-2-yl)indazol-5-yl]-1-methylpyrazol-5-yl]oxybutyl methanesulfonate |
| SMILES | C#Cc1nn(C2CCCCO2)c2ccc(-c3cnn(C)c3OC(C)CCOS(C)(=O)=O)cc12 |
| InChI | InChI=1S/C23H28N4O5S/c1-5-20-18-14-17(9-10-21(18)27(25-20)22-8-6-7-12-30-22)19-15-24-26(3)23(19)32-16(2)11-13-31-33(4,28)29/h1,9-10,14-16,22H,6-8,11-13H2,2-4H3 |
| InChIKey | FFCANZXOAJLKPQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 97.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|