C40H45N5O4 — CID 170434661
5-[[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-6-yl]amino]-1-tert-butyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid (PubChem CID 170434661) has the molecular formula C40H45N5O4 and a molecular weight of 659.83 g/mol. Its IUPAC name is 5-[[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-6-yl]amino]-1-tert-butyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid.
| Compound Name | 5-[[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-6-yl]amino]-1-tert-butyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 170434661 |
| Molecular Formula | C40H45N5O4 |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.35 |
| IUPAC Name | 5-[[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-6-yl]amino]-1-tert-butyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid |
| SMILES | Cn1nc(-c2ccc(OCc3ccccc3)nc2OCc2ccccc2)c2ccc(NC3CCC4C(C3)CN(C(=O)O)C4C(C)(C)C)cc21 |
| InChI | InChI=1S/C40H45N5O4/c1-40(2,3)37-31-17-15-29(21-28(31)23-45(37)39(46)47)41-30-16-18-32-34(22-30)44(4)43-36(32)33-19-20-35(48-24-26-11-7-5-8-12-26)42-38(33)49-25-27-13-9-6-10-14-27/h5-14,16,18-20,22,28-29,31,37,41H,15,17,21,23-25H2,1-4H3,(H,46,47) |
| InChIKey | BCMKXUKZWJFJED-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |