C16H15BrClNO3 — CID 170437238
N-[2-(4-bromophenyl)-2-(4-chlorophenyl)-2-hydroxyethyl]-2-hydroxyacetamide (PubChem CID 170437238) has the molecular formula C16H15BrClNO3 and a molecular weight of 384.66 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)-2-(4-chlorophenyl)-2-hydroxyethyl]-2-hydroxyacetamide.
| Compound Name | N-[2-(4-bromophenyl)-2-(4-chlorophenyl)-2-hydroxyethyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 170437238 |
| Molecular Formula | C16H15BrClNO3 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | N-[2-(4-bromophenyl)-2-(4-chlorophenyl)-2-hydroxyethyl]-2-hydroxyacetamide |
| SMILES | O=C(CO)NCC(O)(c1ccc(Cl)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H15BrClNO3/c17-13-5-1-11(2-6-13)16(22,10-19-15(21)9-20)12-3-7-14(18)8-4-12/h1-8,20,22H,9-10H2,(H,19,21) |
| InChIKey | LCQWOZJPKNQHNH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |