C19H20BrClN2O2 — CID 170437173
(2S)-N-[2-(4-bromophenyl)-2-(4-chlorophenyl)-2-hydroxyethyl]pyrrolidine-2-carboxamide (PubChem CID 170437173) has the molecular formula C19H20BrClN2O2 and a molecular weight of 423.74 g/mol. Its IUPAC name is (2S)-N-[2-(4-bromophenyl)-2-(4-chlorophenyl)-2-hydroxyethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[2-(4-bromophenyl)-2-(4-chlorophenyl)-2-hydroxyethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170437173 |
| Molecular Formula | C19H20BrClN2O2 |
| Molecular Weight | 423.74 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | (2S)-N-[2-(4-bromophenyl)-2-(4-chlorophenyl)-2-hydroxyethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC(O)(c1ccc(Cl)cc1)c1ccc(Br)cc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C19H20BrClN2O2/c20-15-7-3-13(4-8-15)19(25,14-5-9-16(21)10-6-14)12-23-18(24)17-2-1-11-22-17/h3-10,17,22,25H,1-2,11-12H2,(H,23,24)/t17-,19?/m0/s1 |
| InChIKey | PWXUCEAQEBXADF-KKFHFHRHSA-N |
| XLogP | 3.21 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.74 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |