C23H31N3O4 — CID 170437347
tert-butyl 1-[1-(2,6-dioxopiperidin-3-yl)-2,3-dihydroindol-4-yl]piperidine-4-carboxylate (PubChem CID 170437347) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is tert-butyl 1-[1-(2,6-dioxopiperidin-3-yl)-2,3-dihydroindol-4-yl]piperidine-4-carboxylate.
| Compound Name | tert-butyl 1-[1-(2,6-dioxopiperidin-3-yl)-2,3-dihydroindol-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 170437347 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | tert-butyl 1-[1-(2,6-dioxopiperidin-3-yl)-2,3-dihydroindol-4-yl]piperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCN(c2cccc3c2CCN3C2CCC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C23H31N3O4/c1-23(2,3)30-22(29)15-9-12-25(13-10-15)17-5-4-6-18-16(17)11-14-26(18)19-7-8-20(27)24-21(19)28/h4-6,15,19H,7-14H2,1-3H3,(H,24,27,28) |
| InChIKey | CUGKXCBAQCVUOF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|