C23H32N4O2 — CID 170625343
3-[4-(4-cyclohexylpiperazin-1-yl)-2,3-dihydroindol-1-yl]piperidine-2,6-dione (PubChem CID 170625343) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 3-[4-(4-cyclohexylpiperazin-1-yl)-2,3-dihydroindol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-(4-cyclohexylpiperazin-1-yl)-2,3-dihydroindol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170625343 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 3-[4-(4-cyclohexylpiperazin-1-yl)-2,3-dihydroindol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2CCc3c(N4CCN(C5CCCCC5)CC4)cccc32)C(=O)N1 |
| InChI | InChI=1S/C23H32N4O2/c28-22-10-9-21(23(29)24-22)27-12-11-18-19(7-4-8-20(18)27)26-15-13-25(14-16-26)17-5-2-1-3-6-17/h4,7-8,17,21H,1-3,5-6,9-16H2,(H,24,28,29) |
| InChIKey | ZMHOLTKOSVBMTB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|