C24H33N3O4 — CID 170625132
tert-butyl 2-[4-[1-[(3R)-2,6-dioxopiperidin-3-yl]-2,3-dihydroindol-4-yl]piperidin-1-yl]acetate (PubChem CID 170625132) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is tert-butyl 2-[4-[1-[(3R)-2,6-dioxopiperidin-3-yl]-2,3-dihydroindol-4-yl]piperidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[1-[(3R)-2,6-dioxopiperidin-3-yl]-2,3-dihydroindol-4-yl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 170625132 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | tert-butyl 2-[4-[1-[(3R)-2,6-dioxopiperidin-3-yl]-2,3-dihydroindol-4-yl]piperidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCC(c2cccc3c2CCN3[C@@H]2CCC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C24H33N3O4/c1-24(2,3)31-22(29)15-26-12-9-16(10-13-26)17-5-4-6-19-18(17)11-14-27(19)20-7-8-21(28)25-23(20)30/h4-6,16,20H,7-15H2,1-3H3,(H,25,28,30)/t20-/m1/s1 |
| InChIKey | IDLACNAUGYKPCB-HXUWFJFHSA-N |
| XLogP | 2.38 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|