C23H30FN3O4 — CID 170437666
tert-butyl 4-[1-[(3R)-2,6-dioxopiperidin-3-yl]-6-fluoro-2,3-dihydroindol-5-yl]piperidine-1-carboxylate (PubChem CID 170437666) has the molecular formula C23H30FN3O4 and a molecular weight of 431.51 g/mol. Its IUPAC name is tert-butyl 4-[1-[(3R)-2,6-dioxopiperidin-3-yl]-6-fluoro-2,3-dihydroindol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[(3R)-2,6-dioxopiperidin-3-yl]-6-fluoro-2,3-dihydroindol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170437666 |
| Molecular Formula | C23H30FN3O4 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | tert-butyl 4-[1-[(3R)-2,6-dioxopiperidin-3-yl]-6-fluoro-2,3-dihydroindol-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc3c(cc2F)N([C@@H]2CCC(=O)NC2=O)CC3)CC1 |
| InChI | InChI=1S/C23H30FN3O4/c1-23(2,3)31-22(30)26-9-6-14(7-10-26)16-12-15-8-11-27(19(15)13-17(16)24)18-4-5-20(28)25-21(18)29/h12-14,18H,4-11H2,1-3H3,(H,25,28,29)/t18-/m1/s1 |
| InChIKey | UDHDAPIFGMLFRQ-GOSISDBHSA-N |
| XLogP | 3.11 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|