C20H27N3O4 — CID 146244196
tert-butyl 2-[[2-(2,6-dioxopiperidin-3-yl)-1-methyl-1,3-dihydroisoindol-4-yl]amino]acetate (PubChem CID 146244196) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is tert-butyl 2-[[2-(2,6-dioxopiperidin-3-yl)-1-methyl-1,3-dihydroisoindol-4-yl]amino]acetate.
| Compound Name | tert-butyl 2-[[2-(2,6-dioxopiperidin-3-yl)-1-methyl-1,3-dihydroisoindol-4-yl]amino]acetate |
|---|---|
| PubChem CID | 146244196 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | tert-butyl 2-[[2-(2,6-dioxopiperidin-3-yl)-1-methyl-1,3-dihydroisoindol-4-yl]amino]acetate |
| SMILES | CC1c2cccc(NCC(=O)OC(C)(C)C)c2CN1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C20H27N3O4/c1-12-13-6-5-7-15(21-10-18(25)27-20(2,3)4)14(13)11-23(12)16-8-9-17(24)22-19(16)26/h5-7,12,16,21H,8-11H2,1-4H3,(H,22,24,26) |
| InChIKey | PDBHSYSYLHBQIE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|