C21H28N4O7 — CID 167470994
methyl 2-[1-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-4-yl]amino]ethyl]-1-oxidoazetidin-1-ium-3-yl]oxyacetate (PubChem CID 167470994) has the molecular formula C21H28N4O7 and a molecular weight of 448.48 g/mol. Its IUPAC name is methyl 2-[1-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-4-yl]amino]ethyl]-1-oxidoazetidin-1-ium-3-yl]oxyacetate.
| Compound Name | methyl 2-[1-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-4-yl]amino]ethyl]-1-oxidoazetidin-1-ium-3-yl]oxyacetate |
|---|---|
| PubChem CID | 167470994 |
| Molecular Formula | C21H28N4O7 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | methyl 2-[1-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-1,3-dihydroisoindol-4-yl]amino]ethyl]-1-oxidoazetidin-1-ium-3-yl]oxyacetate |
| SMILES | COC(=O)COC1C[N+]([O-])(CCNc2cccc3c2CN(C2CCC(=O)NC2=O)C3O)C1 |
| InChI | InChI=1S/C21H28N4O7/c1-31-19(27)12-32-13-10-25(30,11-13)8-7-22-16-4-2-3-14-15(16)9-24(21(14)29)17-5-6-18(26)23-20(17)28/h2-4,13,17,21-22,29H,5-12H2,1H3,(H,23,26,28) |
| InChIKey | GJLQDWHCRKSSAP-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|