C13H17N3O3S — CID 138740058
(3S)-3-[3-(aminomethyl)-6-hydroxy-4,6-dihydrothieno[3,4-c]pyrrol-5-yl]azepane-2,7-dione (PubChem CID 138740058) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is (3S)-3-[3-(aminomethyl)-6-hydroxy-4,6-dihydrothieno[3,4-c]pyrrol-5-yl]azepane-2,7-dione.
| Compound Name | (3S)-3-[3-(aminomethyl)-6-hydroxy-4,6-dihydrothieno[3,4-c]pyrrol-5-yl]azepane-2,7-dione |
|---|---|
| PubChem CID | 138740058 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (3S)-3-[3-(aminomethyl)-6-hydroxy-4,6-dihydrothieno[3,4-c]pyrrol-5-yl]azepane-2,7-dione |
| SMILES | NCc1scc2c1CN([C@H]1CCCC(=O)NC1=O)C2O |
| InChI | InChI=1S/C13H17N3O3S/c14-4-10-7-5-16(13(19)8(7)6-20-10)9-2-1-3-11(17)15-12(9)18/h6,9,13,19H,1-5,14H2,(H,15,17,18)/t9-,13?/m0/s1 |
| InChIKey | AMAMFWWVIYQPAI-LLTODGECSA-N |
| XLogP | 0.21 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|