C27H23FO8 — CID 170438791
(E)-2-[3-fluoro-4-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]phenyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid (PubChem CID 170438791) has the molecular formula C27H23FO8 and a molecular weight of 494.47 g/mol. Its IUPAC name is (E)-2-[3-fluoro-4-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]phenyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-[3-fluoro-4-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]phenyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 170438791 |
| Molecular Formula | C27H23FO8 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | (E)-2-[3-fluoro-4-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]phenyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)OCc2ccc(/C(=C\c3ccc(O)c(OC)c3)C(=O)O)cc2F)ccc1O |
| InChI | InChI=1S/C27H23FO8/c1-34-24-12-16(3-8-22(24)29)5-10-26(31)36-15-19-7-6-18(14-21(19)28)20(27(32)33)11-17-4-9-23(30)25(13-17)35-2/h3-14,29-30H,15H2,1-2H3,(H,32,33)/b10-5+,20-11+ |
| InChIKey | PXIJQNVRWHPGKB-CEWXCCTESA-N |
| XLogP | 4.64 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|