C23H20O5 — CID 7765917
(2-phenoxyphenyl)methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 7765917) has the molecular formula C23H20O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is (2-phenoxyphenyl)methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | (2-phenoxyphenyl)methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7765917 |
| Molecular Formula | C23H20O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (2-phenoxyphenyl)methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2ccccc2Oc2ccccc2)ccc1O |
| InChI | InChI=1S/C23H20O5/c1-26-22-15-17(11-13-20(22)24)12-14-23(25)27-16-18-7-5-6-10-21(18)28-19-8-3-2-4-9-19/h2-15,24H,16H2,1H3/b14-12+ |
| InChIKey | QNAJBNIPSFBCGV-WYMLVPIESA-N |
| XLogP | 4.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|