C11H12F5NO3S — CID 170439239
[3-[3-(pentafluoro-λ6-sulfanyl)phenoxy]cyclobutyl]carbamic acid (PubChem CID 170439239) has the molecular formula C11H12F5NO3S and a molecular weight of 333.28 g/mol. Its IUPAC name is [3-[3-(pentafluoro-λ6-sulfanyl)phenoxy]cyclobutyl]carbamic acid.
| Compound Name | [3-[3-(pentafluoro-λ6-sulfanyl)phenoxy]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 170439239 |
| Molecular Formula | C11H12F5NO3S |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | [3-[3-(pentafluoro-λ6-sulfanyl)phenoxy]cyclobutyl]carbamic acid |
| SMILES | O=C(O)NC1CC(Oc2cccc(S(F)(F)(F)(F)F)c2)C1 |
| InChI | InChI=1S/C11H12F5NO3S/c12-21(13,14,15,16)10-3-1-2-8(6-10)20-9-4-7(5-9)17-11(18)19/h1-3,6-7,9,17H,4-5H2,(H,18,19) |
| InChIKey | ZLVFSRGPZYPGEM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |