C19H25NO3 — CID 167901824
(E)-3-(3-cyclohexyloxyphenyl)-N-(3-hydroxycyclobutyl)prop-2-enamide (PubChem CID 167901824) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (E)-3-(3-cyclohexyloxyphenyl)-N-(3-hydroxycyclobutyl)prop-2-enamide.
| Compound Name | (E)-3-(3-cyclohexyloxyphenyl)-N-(3-hydroxycyclobutyl)prop-2-enamide |
|---|---|
| PubChem CID | 167901824 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (E)-3-(3-cyclohexyloxyphenyl)-N-(3-hydroxycyclobutyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(OC2CCCCC2)c1)NC1CC(O)C1 |
| InChI | InChI=1S/C19H25NO3/c21-16-12-15(13-16)20-19(22)10-9-14-5-4-8-18(11-14)23-17-6-2-1-3-7-17/h4-5,8-11,15-17,21H,1-3,6-7,12-13H2,(H,20,22)/b10-9+ |
| InChIKey | OWDXQQNRPYJDHO-MDZDMXLPSA-N |
| XLogP | 3.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|