C30H56O6 — CID 170439356
[8-(1,2-dihydroxyethyl)-2,6,10,14-tetramethyl-7,9-dioxopentadecan-8-yl] 2,6-dimethylheptanoate (PubChem CID 170439356) has the molecular formula C30H56O6 and a molecular weight of 512.77 g/mol. Its IUPAC name is [8-(1,2-dihydroxyethyl)-2,6,10,14-tetramethyl-7,9-dioxopentadecan-8-yl] 2,6-dimethylheptanoate.
| Compound Name | [8-(1,2-dihydroxyethyl)-2,6,10,14-tetramethyl-7,9-dioxopentadecan-8-yl] 2,6-dimethylheptanoate |
|---|---|
| PubChem CID | 170439356 |
| Molecular Formula | C30H56O6 |
| Molecular Weight | 512.77 g/mol |
| Exact Mass | 512.41 |
| IUPAC Name | [8-(1,2-dihydroxyethyl)-2,6,10,14-tetramethyl-7,9-dioxopentadecan-8-yl] 2,6-dimethylheptanoate |
| SMILES | CC(C)CCCC(C)C(=O)OC(C(=O)C(C)CCCC(C)C)(C(=O)C(C)CCCC(C)C)C(O)CO |
| InChI | InChI=1S/C30H56O6/c1-20(2)13-10-16-23(7)27(33)30(26(32)19-31,28(34)24(8)17-11-14-21(3)4)36-29(35)25(9)18-12-15-22(5)6/h20-26,31-32H,10-19H2,1-9H3 |
| InChIKey | VMWWFJNRPASGSE-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.77 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|