C30H58N2O6 — CID 166790818
2-amino-8-(6-amino-2,4-dimethylheptanoyl)-8,9-dihydroxy-9-(hydroxymethyl)-4,6,11,15-tetramethylhexadecane-7,10-dione (PubChem CID 166790818) has the molecular formula C30H58N2O6 and a molecular weight of 542.80 g/mol. Its IUPAC name is 2-amino-8-(6-amino-2,4-dimethylheptanoyl)-8,9-dihydroxy-9-(hydroxymethyl)-4,6,11,15-tetramethylhexadecane-7,10-dione.
| Compound Name | 2-amino-8-(6-amino-2,4-dimethylheptanoyl)-8,9-dihydroxy-9-(hydroxymethyl)-4,6,11,15-tetramethylhexadecane-7,10-dione |
|---|---|
| PubChem CID | 166790818 |
| Molecular Formula | C30H58N2O6 |
| Molecular Weight | 542.80 g/mol |
| Exact Mass | 542.43 |
| IUPAC Name | 2-amino-8-(6-amino-2,4-dimethylheptanoyl)-8,9-dihydroxy-9-(hydroxymethyl)-4,6,11,15-tetramethylhexadecane-7,10-dione |
| SMILES | CC(C)CCCC(C)C(=O)C(O)(CO)C(O)(C(=O)C(C)CC(C)CC(C)N)C(=O)C(C)CC(C)CC(C)N |
| InChI | InChI=1S/C30H58N2O6/c1-18(2)11-10-12-21(5)26(34)29(37,17-33)30(38,27(35)22(6)13-19(3)15-24(8)31)28(36)23(7)14-20(4)16-25(9)32/h18-25,33,37-38H,10-17,31-32H2,1-9H3 |
| InChIKey | BXMCVYBLRDWIPS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.80 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|