C11H10F2N4O3 — CID 170439732
1-(2,2-difluoroethyl)-3-(2-methoxy-3-nitrophenyl)-1,2,4-triazole (PubChem CID 170439732) has the molecular formula C11H10F2N4O3 and a molecular weight of 284.22 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-(2-methoxy-3-nitrophenyl)-1,2,4-triazole.
| Compound Name | 1-(2,2-difluoroethyl)-3-(2-methoxy-3-nitrophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 170439732 |
| Molecular Formula | C11H10F2N4O3 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-(2-methoxy-3-nitrophenyl)-1,2,4-triazole |
| SMILES | COc1c(-c2ncn(CC(F)F)n2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10F2N4O3/c1-20-10-7(3-2-4-8(10)17(18)19)11-14-6-16(15-11)5-9(12)13/h2-4,6,9H,5H2,1H3 |
| InChIKey | YIRLVKMPTXMCKQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|