C10H10N4O3 — CID 151375911
1-methyl-3-[3-nitro-2-(trideuteriomethoxy)phenyl]-1,2,4-triazole (PubChem CID 151375911) has the molecular formula C10H10N4O3 and a molecular weight of 237.23 g/mol. Its IUPAC name is 1-methyl-3-[3-nitro-2-(trideuteriomethoxy)phenyl]-1,2,4-triazole.
| Compound Name | 1-methyl-3-[3-nitro-2-(trideuteriomethoxy)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 151375911 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1-methyl-3-[3-nitro-2-(trideuteriomethoxy)phenyl]-1,2,4-triazole |
| SMILES | [2H]C([2H])([2H])Oc1c(-c2ncn(C)n2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N4O3/c1-13-6-11-10(12-13)7-4-3-5-8(14(15)16)9(7)17-2/h3-6H,1-2H3/i2D3 |
| InChIKey | ORKFSKCYGHODCE-BMSJAHLVSA-N |
| XLogP | 1.40 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|