C18H15ClF3N5O4 — CID 171436794
2-chloro-6-[[4-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)-5-nitrophenyl]methoxymethyl]-4-(trifluoromethyl)pyridine (PubChem CID 171436794) has the molecular formula C18H15ClF3N5O4 and a molecular weight of 457.80 g/mol. Its IUPAC name is 2-chloro-6-[[4-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)-5-nitrophenyl]methoxymethyl]-4-(trifluoromethyl)pyridine.
| Compound Name | 2-chloro-6-[[4-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)-5-nitrophenyl]methoxymethyl]-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 171436794 |
| Molecular Formula | C18H15ClF3N5O4 |
| Molecular Weight | 457.80 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 2-chloro-6-[[4-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)-5-nitrophenyl]methoxymethyl]-4-(trifluoromethyl)pyridine |
| SMILES | COc1c(-c2ncn(C)n2)cc(COCc2cc(C(F)(F)F)cc(Cl)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15ClF3N5O4/c1-26-9-23-17(25-26)13-3-10(4-14(27(28)29)16(13)30-2)7-31-8-12-5-11(18(20,21)22)6-15(19)24-12/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | FKFSDQSTZGNHBG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.80 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|