C10H12N4O — CID 155639569
3-(1-methyl-1,2,4-triazol-3-yl)-2-(trideuteriomethoxy)aniline (PubChem CID 155639569) has the molecular formula C10H12N4O and a molecular weight of 207.25 g/mol. Its IUPAC name is 3-(1-methyl-1,2,4-triazol-3-yl)-2-(trideuteriomethoxy)aniline.
| Compound Name | 3-(1-methyl-1,2,4-triazol-3-yl)-2-(trideuteriomethoxy)aniline |
|---|---|
| PubChem CID | 155639569 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 3-(1-methyl-1,2,4-triazol-3-yl)-2-(trideuteriomethoxy)aniline |
| SMILES | [2H]C([2H])([2H])Oc1c(N)cccc1-c1ncn(C)n1 |
| InChI | InChI=1S/C10H12N4O/c1-14-6-12-10(13-14)7-4-3-5-8(11)9(7)15-2/h3-6H,11H2,1-2H3/i2D3 |
| InChIKey | FIAZRZSVFOMYSD-BMSJAHLVSA-N |
| XLogP | 1.07 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|