C9H6F2OS — CID 170441417
2,3-difluoro-5-methyl-1-benzothiophen-4-ol (PubChem CID 170441417) has the molecular formula C9H6F2OS and a molecular weight of 200.21 g/mol. Its IUPAC name is 2,3-difluoro-5-methyl-1-benzothiophen-4-ol.
| Compound Name | 2,3-difluoro-5-methyl-1-benzothiophen-4-ol |
|---|---|
| PubChem CID | 170441417 |
| Molecular Formula | C9H6F2OS |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | 2,3-difluoro-5-methyl-1-benzothiophen-4-ol |
| SMILES | Cc1ccc2sc(F)c(F)c2c1O |
| InChI | InChI=1S/C9H6F2OS/c1-4-2-3-5-6(8(4)12)7(10)9(11)13-5/h2-3,12H,1H3 |
| InChIKey | LMIXTBOIUFWHKY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |