1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid

C8H10F2O3 — CID 170443188

IUPAC1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid
SMILESO=C(O)C1(C(=O)C(F)F)CCCC1
InChIInChI=1S/C8H10F2O3/c9-6(10)5(11)8(7(12)13)3-1-2-4-8/h6H,1-4H2,(H,12,13)
InChIKeyIHEOZUPZSXERLL-UHFFFAOYSA-N
MW192.16 g/mol
LogP1.47
Rot. Bonds3

About 1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid

1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid (PubChem CID 170443188) has the molecular formula C8H10F2O3 and a molecular weight of 192.16 g/mol. Its IUPAC name is 1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid
PubChem CID170443188
Molecular FormulaC8H10F2O3
Molecular Weight192.16 g/mol
Exact Mass192.06
IUPAC Name1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid
SMILESO=C(O)C1(C(=O)C(F)F)CCCC1
InChIInChI=1S/C8H10F2O3/c9-6(10)5(11)8(7(12)13)3-1-2-4-8/h6H,1-4H2,(H,12,13)
InChIKeyIHEOZUPZSXERLL-UHFFFAOYSA-N
XLogP1.47
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.16
LogP ≤ 51.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid?
The IUPAC name of 1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid (CID 170443188) is 1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid?
The canonical SMILES for 1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid is O=C(O)C1(C(=O)C(F)F)CCCC1.
What is the InChIKey of 1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid?
The InChIKey is IHEOZUPZSXERLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2O3/c9-6(10)5(11)8(7(12)13)3-1-2-4-8/h6H,1-4H2,(H,12,13).
What are the key properties of 1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid?
1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid has a molecular weight of 192.16 g/mol, XLogP of 1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroacetyl)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 170443188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).