C10H11N5O4 — CID 170443279
ethyl 2-[(1-hydroxy-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)oxy]acetate (PubChem CID 170443279) has the molecular formula C10H11N5O4 and a molecular weight of 265.23 g/mol. Its IUPAC name is ethyl 2-[(1-hydroxy-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)oxy]acetate.
| Compound Name | ethyl 2-[(1-hydroxy-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)oxy]acetate |
|---|---|
| PubChem CID | 170443279 |
| Molecular Formula | C10H11N5O4 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | ethyl 2-[(1-hydroxy-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)oxy]acetate |
| SMILES | CCOC(=O)COc1nc(-c2cncnc2)n(O)n1 |
| InChI | InChI=1S/C10H11N5O4/c1-2-18-8(16)5-19-10-13-9(15(17)14-10)7-3-11-6-12-4-7/h3-4,6,17H,2,5H2,1H3 |
| InChIKey | USZDVUNDMHLEEN-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|