C18H24N4O6 — CID 170443788
propan-2-yl (2S)-6-diazo-2-[[(2S)-2-methoxy-2-(5-methoxy-3-pyridinyl)acetyl]amino]-5-oxohexanoate (PubChem CID 170443788) has the molecular formula C18H24N4O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is propan-2-yl (2S)-6-diazo-2-[[(2S)-2-methoxy-2-(5-methoxy-3-pyridinyl)acetyl]amino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-diazo-2-[[(2S)-2-methoxy-2-(5-methoxy-3-pyridinyl)acetyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 170443788 |
| Molecular Formula | C18H24N4O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | propan-2-yl (2S)-6-diazo-2-[[(2S)-2-methoxy-2-(5-methoxy-3-pyridinyl)acetyl]amino]-5-oxohexanoate |
| SMILES | COc1cncc([C@H](OC)C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C18H24N4O6/c1-11(2)28-18(25)15(6-5-13(23)9-21-19)22-17(24)16(27-4)12-7-14(26-3)10-20-8-12/h7-11,15-16H,5-6H2,1-4H3,(H,22,24)/t15-,16-/m0/s1 |
| InChIKey | LRZXNTBABQEOQZ-HOTGVXAUSA-N |
| XLogP | 0.86 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|