C9H17ClO — CID 170444047
1-[(Z)-3-chloroprop-2-enoxy]-4-methylpentane (PubChem CID 170444047) has the molecular formula C9H17ClO and a molecular weight of 176.69 g/mol. Its IUPAC name is 1-[(Z)-3-chloroprop-2-enoxy]-4-methylpentane.
| Compound Name | 1-[(Z)-3-chloroprop-2-enoxy]-4-methylpentane |
|---|---|
| PubChem CID | 170444047 |
| Molecular Formula | C9H17ClO |
| Molecular Weight | 176.69 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 1-[(Z)-3-chloroprop-2-enoxy]-4-methylpentane |
| SMILES | CC(C)CCCOC/C=C\Cl |
| InChI | InChI=1S/C9H17ClO/c1-9(2)5-3-7-11-8-4-6-10/h4,6,9H,3,5,7-8H2,1-2H3/b6-4- |
| InChIKey | AAHSBZXNMWUQEG-XQRVVYSFSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.69 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|