C24H24FNO2 — CID 170446465
4-[4-(dimethylamino)phenyl]-3-(2-fluoro-5-methylphenyl)-3,4-dihydro-2H-chromen-7-ol (PubChem CID 170446465) has the molecular formula C24H24FNO2 and a molecular weight of 377.46 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]-3-(2-fluoro-5-methylphenyl)-3,4-dihydro-2H-chromen-7-ol.
| Compound Name | 4-[4-(dimethylamino)phenyl]-3-(2-fluoro-5-methylphenyl)-3,4-dihydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 170446465 |
| Molecular Formula | C24H24FNO2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]-3-(2-fluoro-5-methylphenyl)-3,4-dihydro-2H-chromen-7-ol |
| SMILES | Cc1ccc(F)c(C2COc3cc(O)ccc3C2c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C24H24FNO2/c1-15-4-11-22(25)20(12-15)21-14-28-23-13-18(27)9-10-19(23)24(21)16-5-7-17(8-6-16)26(2)3/h4-13,21,24,27H,14H2,1-3H3 |
| InChIKey | XRKUFXSHTLGDLL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|