C16H17NO2 — CID 82978423
3-(N,4-dimethylanilino)-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 82978423) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-(N,4-dimethylanilino)-2,3-dihydro-1-benzofuran-6-ol.
| Compound Name | 3-(N,4-dimethylanilino)-2,3-dihydro-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 82978423 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-(N,4-dimethylanilino)-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | Cc1ccc(N(C)C2COc3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C16H17NO2/c1-11-3-5-12(6-4-11)17(2)15-10-19-16-9-13(18)7-8-14(15)16/h3-9,15,18H,10H2,1-2H3 |
| InChIKey | HOBAMVNUTMIARO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|