C18H18ClN3 — CID 170449646
4-(3-chloro-4-piperidin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 170449646) has the molecular formula C18H18ClN3 and a molecular weight of 311.82 g/mol. Its IUPAC name is 4-(3-chloro-4-piperidin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-(3-chloro-4-piperidin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 170449646 |
| Molecular Formula | C18H18ClN3 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-(3-chloro-4-piperidin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Clc1cc(-c2ccnc3[nH]ccc23)ccc1C1CCNCC1 |
| InChI | InChI=1S/C18H18ClN3/c19-17-11-13(1-2-15(17)12-3-7-20-8-4-12)14-5-9-21-18-16(14)6-10-22-18/h1-2,5-6,9-12,20H,3-4,7-8H2,(H,21,22) |
| InChIKey | ODQPWEVLXNDLEX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |