About 4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane
4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane (PubChem CID 170614297) has the molecular formula C22H25N3
and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane.
Molecular Properties
| Compound Name | 4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane |
| PubChem CID | 170614297 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane |
| SMILES | c1cc(-c2ccc(C3CCC4CCC(CC3)N4)cc2)c2cc[nH]c2n1 |
| InChI | InChI=1S/C22H25N3/c1-3-17(20-11-13-23-22-21(20)12-14-24-22)4-2-15(1)16-5-7-18-9-10-19(25-18)8-6-16/h1-4,11-14,16,18-19,25H,5-10H2,(H,23,24) |
| InChIKey | CRRSCSLGHXULOP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane?
The IUPAC name of 4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane (CID 170614297) is 4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane.
What is the SMILES notation for 4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane?
The canonical SMILES for 4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane is c1cc(-c2ccc(C3CCC4CCC(CC3)N4)cc2)c2cc[nH]c2n1.
What is the InChIKey of 4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane?
The InChIKey is CRRSCSLGHXULOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3/c1-3-17(20-11-13-23-22-21(20)12-14-24-22)4-2-15(1)16-5-7-18-9-10-19(25-18)8-6-16/h1-4,11-14,16,18-19,25H,5-10H2,(H,23,24).
What are the key properties of 4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane?
4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane has a molecular weight of 331.46 g/mol, XLogP of 5.01, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]-10-azabicyclo[5.2.1]decane is sourced from PubChem (CID 170614297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).